C15H20FNO4S — CID 97388841
(2S,3aS,7aR)-5-(3-fluoro-4-methoxyphenyl)sulfonyl-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine (PubChem CID 97388841) has the molecular formula C15H20FNO4S and a molecular weight of 329.39 g/mol. Its IUPAC name is (2S,3aS,7aR)-5-(3-fluoro-4-methoxyphenyl)sulfonyl-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine.
| Compound Name | (2S,3aS,7aR)-5-(3-fluoro-4-methoxyphenyl)sulfonyl-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 97388841 |
| Molecular Formula | C15H20FNO4S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (2S,3aS,7aR)-5-(3-fluoro-4-methoxyphenyl)sulfonyl-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
| SMILES | COc1ccc(S(=O)(=O)N2CC[C@H]3O[C@@H](C)C[C@H]3C2)cc1F |
| InChI | InChI=1S/C15H20FNO4S/c1-10-7-11-9-17(6-5-14(11)21-10)22(18,19)12-3-4-15(20-2)13(16)8-12/h3-4,8,10-11,14H,5-7,9H2,1-2H3/t10-,11-,14+/m0/s1 |
| InChIKey | SECIHMLINZYVTP-COPLHBTASA-N |
| XLogP | 2.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |