C21H21NO7S2 — CID 90594797
3-(furan-2-ylmethylsulfonyl)-1-[4-(2-methoxyphenoxy)phenyl]sulfonylazetidine (PubChem CID 90594797) has the molecular formula C21H21NO7S2 and a molecular weight of 463.53 g/mol. Its IUPAC name is 3-(furan-2-ylmethylsulfonyl)-1-[4-(2-methoxyphenoxy)phenyl]sulfonylazetidine.
| Compound Name | 3-(furan-2-ylmethylsulfonyl)-1-[4-(2-methoxyphenoxy)phenyl]sulfonylazetidine |
|---|---|
| PubChem CID | 90594797 |
| Molecular Formula | C21H21NO7S2 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 3-(furan-2-ylmethylsulfonyl)-1-[4-(2-methoxyphenoxy)phenyl]sulfonylazetidine |
| SMILES | COc1ccccc1Oc1ccc(S(=O)(=O)N2CC(S(=O)(=O)Cc3ccco3)C2)cc1 |
| InChI | InChI=1S/C21H21NO7S2/c1-27-20-6-2-3-7-21(20)29-16-8-10-18(11-9-16)31(25,26)22-13-19(14-22)30(23,24)15-17-5-4-12-28-17/h2-12,19H,13-15H2,1H3 |
| InChIKey | BGLULCVGSRGHOB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |