C23H25NO6S2 — CID 90590757
4-(furan-2-ylmethylsulfonyl)-1-[4-(4-methoxyphenyl)phenyl]sulfonylpiperidine (PubChem CID 90590757) has the molecular formula C23H25NO6S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfonyl)-1-[4-(4-methoxyphenyl)phenyl]sulfonylpiperidine.
| Compound Name | 4-(furan-2-ylmethylsulfonyl)-1-[4-(4-methoxyphenyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90590757 |
| Molecular Formula | C23H25NO6S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 4-(furan-2-ylmethylsulfonyl)-1-[4-(4-methoxyphenyl)phenyl]sulfonylpiperidine |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)N3CCC(S(=O)(=O)Cc4ccco4)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H25NO6S2/c1-29-20-8-4-18(5-9-20)19-6-10-23(11-7-19)32(27,28)24-14-12-22(13-15-24)31(25,26)17-21-3-2-16-30-21/h2-11,16,22H,12-15,17H2,1H3 |
| InChIKey | IMGQBRSEFFXILC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |