C20H19NO5S2 — CID 90594817
3-(furan-2-ylmethylsulfonyl)-1-(3-phenylphenyl)sulfonylazetidine (PubChem CID 90594817) has the molecular formula C20H19NO5S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-(furan-2-ylmethylsulfonyl)-1-(3-phenylphenyl)sulfonylazetidine.
| Compound Name | 3-(furan-2-ylmethylsulfonyl)-1-(3-phenylphenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 90594817 |
| Molecular Formula | C20H19NO5S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 3-(furan-2-ylmethylsulfonyl)-1-(3-phenylphenyl)sulfonylazetidine |
| SMILES | O=S(=O)(Cc1ccco1)C1CN(S(=O)(=O)c2cccc(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C20H19NO5S2/c22-27(23,15-18-9-5-11-26-18)20-13-21(14-20)28(24,25)19-10-4-8-17(12-19)16-6-2-1-3-7-16/h1-12,20H,13-15H2 |
| InChIKey | OYOYNRFQXSXGPS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |