C15H16ClNO5S2 — CID 90594792
1-[(4-chlorophenyl)methylsulfonyl]-3-(furan-2-ylmethylsulfonyl)azetidine (PubChem CID 90594792) has the molecular formula C15H16ClNO5S2 and a molecular weight of 389.88 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methylsulfonyl]-3-(furan-2-ylmethylsulfonyl)azetidine.
| Compound Name | 1-[(4-chlorophenyl)methylsulfonyl]-3-(furan-2-ylmethylsulfonyl)azetidine |
|---|---|
| PubChem CID | 90594792 |
| Molecular Formula | C15H16ClNO5S2 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 1-[(4-chlorophenyl)methylsulfonyl]-3-(furan-2-ylmethylsulfonyl)azetidine |
| SMILES | O=S(=O)(Cc1ccco1)C1CN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H16ClNO5S2/c16-13-5-3-12(4-6-13)10-24(20,21)17-8-15(9-17)23(18,19)11-14-2-1-7-22-14/h1-7,15H,8-11H2 |
| InChIKey | BRBHCHAHTLWWAX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |