C19H30N2O5S — CID 47068804
1-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-1,4-diazepan-1-yl]butan-1-one (PubChem CID 47068804) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 1-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 47068804 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCCN(S(=O)(=O)c2ccc(OCCOC)c(C)c2)CC1 |
| InChI | InChI=1S/C19H30N2O5S/c1-4-6-19(22)20-9-5-10-21(12-11-20)27(23,24)17-7-8-18(16(2)15-17)26-14-13-25-3/h7-8,15H,4-6,9-14H2,1-3H3 |
| InChIKey | RPTZIBNLFDKEIP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|