C16H21N3O4S — CID 110796800
1-[4-(1,3-benzoxazol-6-ylsulfonyl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 110796800) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-6-ylsulfonyl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 1-[4-(1,3-benzoxazol-6-ylsulfonyl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110796800 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-6-ylsulfonyl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCCN(S(=O)(=O)c2ccc3ncoc3c2)CC1 |
| InChI | InChI=1S/C16H21N3O4S/c1-2-4-16(20)18-7-3-8-19(10-9-18)24(21,22)13-5-6-14-15(11-13)23-12-17-14/h5-6,11-12H,2-4,7-10H2,1H3 |
| InChIKey | KCOLTJSYGYVTNH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |