C19H31N3O5S — CID 55681655
2-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-1,4-diazepan-1-yl]-N,N-dimethylacetamide (PubChem CID 55681655) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-1,4-diazepan-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-1,4-diazepan-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 55681655 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-1,4-diazepan-1-yl]-N,N-dimethylacetamide |
| SMILES | COCCOc1ccc(S(=O)(=O)N2CCCN(CC(=O)N(C)C)CC2)cc1C |
| InChI | InChI=1S/C19H31N3O5S/c1-16-14-17(6-7-18(16)27-13-12-26-4)28(24,25)22-9-5-8-21(10-11-22)15-19(23)20(2)3/h6-7,14H,5,8-13,15H2,1-4H3 |
| InChIKey | SGJSNQCUSCIOCZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|