C18H27N3O5S — CID 45106429
1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-3-(oxolan-2-ylmethyl)urea (PubChem CID 45106429) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-3-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-3-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 45106429 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-3-(oxolan-2-ylmethyl)urea |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(NC(=O)NCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C18H27N3O5S/c1-25-15-4-6-17(7-5-15)27(23,24)21-10-8-14(9-11-21)20-18(22)19-13-16-3-2-12-26-16/h4-7,14,16H,2-3,8-13H2,1H3,(H2,19,20,22) |
| InChIKey | GUTKLXIRNQYIHC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |