C16H23FN4O5S — CID 22876272
(2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid;piperazine-1-carboxamide (PubChem CID 22876272) has the molecular formula C16H23FN4O5S and a molecular weight of 402.45 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid;piperazine-1-carboxamide.
| Compound Name | (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid;piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22876272 |
| Molecular Formula | C16H23FN4O5S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid;piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCNCC1.O=C(O)[C@@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FNO4S.C5H11N3O/c12-8-3-5-9(6-4-8)18(16,17)13-7-1-2-10(13)11(14)15;6-5(9)8-3-1-7-2-4-8/h3-6,10H,1-2,7H2,(H,14,15);7H,1-4H2,(H2,6,9)/t10-;/m0./s1 |
| InChIKey | YXAYPRCGBRKOBZ-PPHPATTJSA-N |
| XLogP | 0.03 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |