C12H15FN2O5S — CID 115589516
4-(3-fluoro-2-nitrophenyl)sulfonyl-2,5-dimethylmorpholine (PubChem CID 115589516) has the molecular formula C12H15FN2O5S and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-(3-fluoro-2-nitrophenyl)sulfonyl-2,5-dimethylmorpholine.
| Compound Name | 4-(3-fluoro-2-nitrophenyl)sulfonyl-2,5-dimethylmorpholine |
|---|---|
| PubChem CID | 115589516 |
| Molecular Formula | C12H15FN2O5S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-(3-fluoro-2-nitrophenyl)sulfonyl-2,5-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2cccc(F)c2[N+](=O)[O-])C(C)CO1 |
| InChI | InChI=1S/C12H15FN2O5S/c1-8-7-20-9(2)6-14(8)21(18,19)11-5-3-4-10(13)12(11)15(16)17/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | FBSLPMDYFQSSEB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|