C13H17FN2O4S — CID 104967306
(2S,6R)-1-(3-fluoro-2-nitrophenyl)sulfonyl-2,6-dimethylpiperidine (PubChem CID 104967306) has the molecular formula C13H17FN2O4S and a molecular weight of 316.35 g/mol. Its IUPAC name is (2S,6R)-1-(3-fluoro-2-nitrophenyl)sulfonyl-2,6-dimethylpiperidine.
| Compound Name | (2S,6R)-1-(3-fluoro-2-nitrophenyl)sulfonyl-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 104967306 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (2S,6R)-1-(3-fluoro-2-nitrophenyl)sulfonyl-2,6-dimethylpiperidine |
| SMILES | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17FN2O4S/c1-9-5-3-6-10(2)15(9)21(19,20)12-8-4-7-11(14)13(12)16(17)18/h4,7-10H,3,5-6H2,1-2H3/t9-,10+ |
| InChIKey | MUWNSPYQXIQCDI-AOOOYVTPSA-N |
| XLogP | 2.69 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|