C14H16F3NO5S — CID 3775996
methyl 1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidine-2-carboxylate (PubChem CID 3775996) has the molecular formula C14H16F3NO5S and a molecular weight of 367.35 g/mol. Its IUPAC name is methyl 1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidine-2-carboxylate.
| Compound Name | methyl 1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 3775996 |
| Molecular Formula | C14H16F3NO5S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | methyl 1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1S(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H16F3NO5S/c1-22-13(19)10-6-4-5-9-18(10)24(20,21)12-8-3-2-7-11(12)23-14(15,16)17/h2-3,7-8,10H,4-6,9H2,1H3 |
| InChIKey | MBISMSOTQKGJAL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |