C7H4F3IO5S — CID 23357228
2-iodosyl-3-(trifluoromethoxy)benzenesulfonic acid (PubChem CID 23357228) has the molecular formula C7H4F3IO5S and a molecular weight of 384.07 g/mol. Its IUPAC name is 2-iodosyl-3-(trifluoromethoxy)benzenesulfonic acid.
| Compound Name | 2-iodosyl-3-(trifluoromethoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 23357228 |
| Molecular Formula | C7H4F3IO5S |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 383.88 |
| IUPAC Name | 2-iodosyl-3-(trifluoromethoxy)benzenesulfonic acid |
| SMILES | O=Ic1c(OC(F)(F)F)cccc1S(=O)(=O)O |
| InChI | InChI=1S/C7H4F3IO5S/c8-7(9,10)16-4-2-1-3-5(6(4)11-12)17(13,14)15/h1-3H,(H,13,14,15) |
| InChIKey | PDPCKCRIOHMXRX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|