C10H13N3O6S — CID 115992099
2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]oxyacetamide (PubChem CID 115992099) has the molecular formula C10H13N3O6S and a molecular weight of 303.30 g/mol. Its IUPAC name is 2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 115992099 |
| Molecular Formula | C10H13N3O6S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]oxyacetamide |
| SMILES | Cc1cc(S(=O)(=O)NOCC(N)=O)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C10H13N3O6S/c1-6-3-8(4-9(7(6)2)13(15)16)20(17,18)12-19-5-10(11)14/h3-4,12H,5H2,1-2H3,(H2,11,14) |
| InChIKey | VUOCKSDUVURBIB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|