C14H18N4O4S — CID 94181205
2-methoxy-5-[[(2S)-1-pyrazol-1-ylpropan-2-yl]sulfamoyl]benzamide (PubChem CID 94181205) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-methoxy-5-[[(2S)-1-pyrazol-1-ylpropan-2-yl]sulfamoyl]benzamide.
| Compound Name | 2-methoxy-5-[[(2S)-1-pyrazol-1-ylpropan-2-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 94181205 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-methoxy-5-[[(2S)-1-pyrazol-1-ylpropan-2-yl]sulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)Cn2cccn2)cc1C(N)=O |
| InChI | InChI=1S/C14H18N4O4S/c1-10(9-18-7-3-6-16-18)17-23(20,21)11-4-5-13(22-2)12(8-11)14(15)19/h3-8,10,17H,9H2,1-2H3,(H2,15,19)/t10-/m0/s1 |
| InChIKey | PLKFNYOFCVSXMI-JTQLQIEISA-N |
| XLogP | 0.36 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |