C14H18N4O3S — CID 94024841
2-methyl-5-[[(2S)-1-pyrazol-1-ylpropan-2-yl]sulfamoyl]benzamide (PubChem CID 94024841) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-methyl-5-[[(2S)-1-pyrazol-1-ylpropan-2-yl]sulfamoyl]benzamide.
| Compound Name | 2-methyl-5-[[(2S)-1-pyrazol-1-ylpropan-2-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 94024841 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-methyl-5-[[(2S)-1-pyrazol-1-ylpropan-2-yl]sulfamoyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)Cn2cccn2)cc1C(N)=O |
| InChI | InChI=1S/C14H18N4O3S/c1-10-4-5-12(8-13(10)14(15)19)22(20,21)17-11(2)9-18-7-3-6-16-18/h3-8,11,17H,9H2,1-2H3,(H2,15,19)/t11-/m0/s1 |
| InChIKey | XXDHJKZXFKYCHH-NSHDSACASA-N |
| XLogP | 0.66 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |