C17H15N3O6S — CID 31068036
benzyl 2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]acetate (PubChem CID 31068036) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is benzyl 2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]acetate.
| Compound Name | benzyl 2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 31068036 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | benzyl 2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1)OCc1ccccc1 |
| InChI | InChI=1S/C17H15N3O6S/c21-15(26-10-11-4-2-1-3-5-11)9-18-27(24,25)12-6-7-13-14(8-12)20-17(23)16(22)19-13/h1-8,18H,9-10H2,(H,19,22)(H,20,23) |
| InChIKey | FBQOEDPLFDMRIR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|