C23H25NO5S — CID 16516055
2-(2,6-dimethylphenoxy)ethyl 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 16516055) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)ethyl 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | 2-(2,6-dimethylphenoxy)ethyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 16516055 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)ethyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | Cc1cccc(C)c1OCCOC(=O)CCNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H25NO5S/c1-17-6-5-7-18(2)23(17)29-15-14-28-22(25)12-13-24-30(26,27)21-11-10-19-8-3-4-9-20(19)16-21/h3-11,16,24H,12-15H2,1-2H3 |
| InChIKey | INYYTADSMYGVSL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|