C18H16ClNO3 — CID 46678719
2-chloroprop-2-enyl 2-[(2-phenylacetyl)amino]benzoate (PubChem CID 46678719) has the molecular formula C18H16ClNO3 and a molecular weight of 329.78 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 2-[(2-phenylacetyl)amino]benzoate.
| Compound Name | 2-chloroprop-2-enyl 2-[(2-phenylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 46678719 |
| Molecular Formula | C18H16ClNO3 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-chloroprop-2-enyl 2-[(2-phenylacetyl)amino]benzoate |
| SMILES | C=C(Cl)COC(=O)c1ccccc1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H16ClNO3/c1-13(19)12-23-18(22)15-9-5-6-10-16(15)20-17(21)11-14-7-3-2-4-8-14/h2-10H,1,11-12H2,(H,20,21) |
| InChIKey | VHKTWHUBWUHPRS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |