C25H21N3O4 — CID 28593747
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate (PubChem CID 28593747) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 28593747 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate |
| SMILES | N#CCc1ccc(NC(=O)COC(=O)c2ccccc2NC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3O4/c26-15-14-18-10-12-20(13-11-18)27-24(30)17-32-25(31)21-8-4-5-9-22(21)28-23(29)16-19-6-2-1-3-7-19/h1-13H,14,16-17H2,(H,27,30)(H,28,29) |
| InChIKey | CQXZBBHXPOGLKL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |