C34H47NO3 — CID 70420704
[2-oxo-2-[2-(2-phenylethyl)anilino]ethyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 70420704) has the molecular formula C34H47NO3 and a molecular weight of 517.75 g/mol. Its IUPAC name is [2-oxo-2-[2-(2-phenylethyl)anilino]ethyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-oxo-2-[2-(2-phenylethyl)anilino]ethyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 70420704 |
| Molecular Formula | C34H47NO3 |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.36 |
| IUPAC Name | [2-oxo-2-[2-(2-phenylethyl)anilino]ethyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(=O)Nc1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C34H47NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-26-34(37)38-29-33(36)35-32-25-21-20-24-31(32)28-27-30-22-17-16-18-23-30/h6-7,9-10,16-18,20-25H,2-5,8,11-15,19,26-29H2,1H3,(H,35,36)/b7-6-,10-9- |
| InChIKey | ZKZYFORYJRKLOW-HZJYTTRNSA-N |
| XLogP | 8.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|