C22H26N2O5 — CID 9067653
[2-(4-methoxyanilino)-2-oxoethyl] 5-(2-ethylanilino)-5-oxopentanoate (PubChem CID 9067653) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 5-(2-ethylanilino)-5-oxopentanoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 5-(2-ethylanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 9067653 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 5-(2-ethylanilino)-5-oxopentanoate |
| SMILES | CCc1ccccc1NC(=O)CCCC(=O)OCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-3-16-7-4-5-8-19(16)24-20(25)9-6-10-22(27)29-15-21(26)23-17-11-13-18(28-2)14-12-17/h4-5,7-8,11-14H,3,6,9-10,15H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | IASFNNZDQFRTIP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |