C27H27N3O6 — CID 17259393
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-[4-(2,6-dimethylphenoxy)anilino]-4-oxobutanoate (PubChem CID 17259393) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-[4-(2,6-dimethylphenoxy)anilino]-4-oxobutanoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-[4-(2,6-dimethylphenoxy)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17259393 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-[4-(2,6-dimethylphenoxy)anilino]-4-oxobutanoate |
| SMILES | Cc1cccc(C)c1Oc1ccc(NC(=O)CCC(=O)OCC(=O)NNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N3O6/c1-18-7-6-8-19(2)26(18)36-22-13-11-21(12-14-22)28-23(31)15-16-25(33)35-17-24(32)29-30-27(34)20-9-4-3-5-10-20/h3-14H,15-17H2,1-2H3,(H,28,31)(H,29,32)(H,30,34) |
| InChIKey | GLZNDYUIOKAAIH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|