C22H25N3O5 — CID 17260653
[2-(2,3-dimethylanilino)-2-oxoethyl] 5-(2-benzoylhydrazinyl)-5-oxopentanoate (PubChem CID 17260653) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-(2,3-dimethylanilino)-2-oxoethyl] 5-(2-benzoylhydrazinyl)-5-oxopentanoate.
| Compound Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 5-(2-benzoylhydrazinyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 17260653 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 5-(2-benzoylhydrazinyl)-5-oxopentanoate |
| SMILES | Cc1cccc(NC(=O)COC(=O)CCCC(=O)NNC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C22H25N3O5/c1-15-8-6-11-18(16(15)2)23-20(27)14-30-21(28)13-7-12-19(26)24-25-22(29)17-9-4-3-5-10-17/h3-6,8-11H,7,12-14H2,1-2H3,(H,23,27)(H,24,26)(H,25,29) |
| InChIKey | MJGVEFQAFVICKG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|