C20H20ClN3O5 — CID 17258404
[2-(3-chloroanilino)-2-oxoethyl] 5-(2-benzoylhydrazinyl)-5-oxopentanoate (PubChem CID 17258404) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 5-(2-benzoylhydrazinyl)-5-oxopentanoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 5-(2-benzoylhydrazinyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 17258404 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 5-(2-benzoylhydrazinyl)-5-oxopentanoate |
| SMILES | O=C(CCCC(=O)OCC(=O)Nc1cccc(Cl)c1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20ClN3O5/c21-15-8-4-9-16(12-15)22-18(26)13-29-19(27)11-5-10-17(25)23-24-20(28)14-6-2-1-3-7-14/h1-4,6-9,12H,5,10-11,13H2,(H,22,26)(H,23,25)(H,24,28) |
| InChIKey | OFOUDOCZEYTZPN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|