C14H11BrN2O2S — CID 4939197
2-bromo-N-[(3-hydroxyphenyl)carbamothioyl]benzamide (PubChem CID 4939197) has the molecular formula C14H11BrN2O2S and a molecular weight of 351.23 g/mol. Its IUPAC name is 2-bromo-N-[(3-hydroxyphenyl)carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[(3-hydroxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4939197 |
| Molecular Formula | C14H11BrN2O2S |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 2-bromo-N-[(3-hydroxyphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(O)c1)c1ccccc1Br |
| InChI | InChI=1S/C14H11BrN2O2S/c15-12-7-2-1-6-11(12)13(19)17-14(20)16-9-4-3-5-10(18)8-9/h1-8,18H,(H2,16,17,19,20) |
| InChIKey | WVZFHNUAUQWBGR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|