C31H35AlN2O2S — CID 173455048
1,3-bis(4-ethoxyphenyl)thiourea;dibenzylalumane (PubChem CID 173455048) has the molecular formula C31H35AlN2O2S and a molecular weight of 526.68 g/mol. Its IUPAC name is 1,3-bis(4-ethoxyphenyl)thiourea;dibenzylalumane.
| Compound Name | 1,3-bis(4-ethoxyphenyl)thiourea;dibenzylalumane |
|---|---|
| PubChem CID | 173455048 |
| Molecular Formula | C31H35AlN2O2S |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 1,3-bis(4-ethoxyphenyl)thiourea;dibenzylalumane |
| SMILES | CCOc1ccc(NC(=S)Nc2ccc(OCC)cc2)cc1.c1ccc(C[AlH]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2O2S.2C7H7.Al.H/c1-3-20-15-9-5-13(6-10-15)18-17(22)19-14-7-11-16(12-8-14)21-4-2;2*1-7-5-3-2-4-6-7;;/h5-12H,3-4H2,1-2H3,(H2,18,19,22);2*2-6H,1H2;; |
| InChIKey | JBZLYFMAZDQPBA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|