C15H17Cl2N2O+ — CID 7228189
(3,5-dichloro-2-ethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium (PubChem CID 7228189) has the molecular formula C15H17Cl2N2O+ and a molecular weight of 312.22 g/mol. Its IUPAC name is (3,5-dichloro-2-ethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium.
| Compound Name | (3,5-dichloro-2-ethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 7228189 |
| Molecular Formula | C15H17Cl2N2O+ |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (3,5-dichloro-2-ethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium |
| SMILES | CCOc1c(Cl)cc(Cl)cc1C[NH2+]Cc1cccnc1 |
| InChI | InChI=1S/C15H16Cl2N2O/c1-2-20-15-12(6-13(16)7-14(15)17)10-19-9-11-4-3-5-18-8-11/h3-8,19H,2,9-10H2,1H3/p+1 |
| InChIKey | XPXVCBGJNHXUGO-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 38.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |