C20H26Br2Cl2N2O2 — CID 17159778
N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride (PubChem CID 17159778) has the molecular formula C20H26Br2Cl2N2O2 and a molecular weight of 557.15 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride.
| Compound Name | N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 17159778 |
| Molecular Formula | C20H26Br2Cl2N2O2 |
| Molecular Weight | 557.15 g/mol |
| Exact Mass | 553.97 |
| IUPAC Name | N-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
| SMILES | Brc1cc(CNCCN2CCOCC2)cc(Br)c1OCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C20H24Br2N2O2.2ClH/c21-18-12-17(14-23-6-7-24-8-10-25-11-9-24)13-19(22)20(18)26-15-16-4-2-1-3-5-16;;/h1-5,12-13,23H,6-11,14-15H2;2*1H |
| InChIKey | VAGBRAIFFNDNHP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.15 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|