C23H30N2O3 — CID 17212137
1-[3-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]propyl]pyrrolidin-2-one (PubChem CID 17212137) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-[3-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17212137 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1-[3-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]propyl]pyrrolidin-2-one |
| SMILES | COc1cc(CNCCCN2CCCC2=O)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C23H30N2O3/c1-18-6-8-19(9-7-18)17-28-21-11-10-20(15-22(21)27-2)16-24-12-4-14-25-13-3-5-23(25)26/h6-11,15,24H,3-5,12-14,16-17H2,1-2H3 |
| InChIKey | WPIONBBHXYYULT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|