C19H27NO5 — CID 91724096
pentan-2-yl (E)-4-[2-(3,4-dimethoxyphenyl)ethylamino]-4-oxobut-2-enoate (PubChem CID 91724096) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is pentan-2-yl (E)-4-[2-(3,4-dimethoxyphenyl)ethylamino]-4-oxobut-2-enoate.
| Compound Name | pentan-2-yl (E)-4-[2-(3,4-dimethoxyphenyl)ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 91724096 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | pentan-2-yl (E)-4-[2-(3,4-dimethoxyphenyl)ethylamino]-4-oxobut-2-enoate |
| SMILES | CCCC(C)OC(=O)/C=C/C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H27NO5/c1-5-6-14(2)25-19(22)10-9-18(21)20-12-11-15-7-8-16(23-3)17(13-15)24-4/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,20,21)/b10-9+ |
| InChIKey | HYIPBMWXRKMMNI-MDZDMXLPSA-N |
| XLogP | 2.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|