C19H22BrNO2 — CID 113101258
2-(3-bromophenyl)-N-[2-(2,4,5-trimethylphenoxy)ethyl]acetamide (PubChem CID 113101258) has the molecular formula C19H22BrNO2 and a molecular weight of 376.29 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[2-(2,4,5-trimethylphenoxy)ethyl]acetamide.
| Compound Name | 2-(3-bromophenyl)-N-[2-(2,4,5-trimethylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 113101258 |
| Molecular Formula | C19H22BrNO2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-(3-bromophenyl)-N-[2-(2,4,5-trimethylphenoxy)ethyl]acetamide |
| SMILES | Cc1cc(C)c(OCCNC(=O)Cc2cccc(Br)c2)cc1C |
| InChI | InChI=1S/C19H22BrNO2/c1-13-9-15(3)18(10-14(13)2)23-8-7-21-19(22)12-16-5-4-6-17(20)11-16/h4-6,9-11H,7-8,12H2,1-3H3,(H,21,22) |
| InChIKey | DMJNADMZSKPHGI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|