C19H21F3N2O3 — CID 60580823
1-[3-(4-methoxyphenoxy)propyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 60580823) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenoxy)propyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[3-(4-methoxyphenoxy)propyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 60580823 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[3-(4-methoxyphenoxy)propyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | COc1ccc(OCCCNC(=O)NCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H21F3N2O3/c1-26-16-6-8-17(9-7-16)27-11-3-10-23-18(25)24-13-14-4-2-5-15(12-14)19(20,21)22/h2,4-9,12H,3,10-11,13H2,1H3,(H2,23,24,25) |
| InChIKey | AZLJOQHMKDUFFU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|