C10H15Cl2N2O2S+ — CID 2128469
2-[(2,6-dichlorophenyl)sulfonylamino]ethyl-dimethylazanium (PubChem CID 2128469) has the molecular formula C10H15Cl2N2O2S+ and a molecular weight of 298.22 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)sulfonylamino]ethyl-dimethylazanium.
| Compound Name | 2-[(2,6-dichlorophenyl)sulfonylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 2128469 |
| Molecular Formula | C10H15Cl2N2O2S+ |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)sulfonylamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H14Cl2N2O2S/c1-14(2)7-6-13-17(15,16)10-8(11)4-3-5-9(10)12/h3-5,13H,6-7H2,1-2H3/p+1 |
| InChIKey | VSPDKZBBSJQNTB-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |