C10H13Cl2NO4S — CID 39847484
3,4-dichloro-N-(3-hydroxypropyl)-2-methoxybenzenesulfonamide (PubChem CID 39847484) has the molecular formula C10H13Cl2NO4S and a molecular weight of 314.19 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-hydroxypropyl)-2-methoxybenzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(3-hydroxypropyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 39847484 |
| Molecular Formula | C10H13Cl2NO4S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 3,4-dichloro-N-(3-hydroxypropyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1c(S(=O)(=O)NCCCO)ccc(Cl)c1Cl |
| InChI | InChI=1S/C10H13Cl2NO4S/c1-17-10-8(4-3-7(11)9(10)12)18(15,16)13-5-2-6-14/h3-4,13-14H,2,5-6H2,1H3 |
| InChIKey | SYKHCWXHJHZSTK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|