C11H14ClFN2O3S — CID 90007961
1-tert-butyl-3-(2-chloro-5-fluorophenyl)sulfonylurea (PubChem CID 90007961) has the molecular formula C11H14ClFN2O3S and a molecular weight of 308.76 g/mol. Its IUPAC name is 1-tert-butyl-3-(2-chloro-5-fluorophenyl)sulfonylurea.
| Compound Name | 1-tert-butyl-3-(2-chloro-5-fluorophenyl)sulfonylurea |
|---|---|
| PubChem CID | 90007961 |
| Molecular Formula | C11H14ClFN2O3S |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-tert-butyl-3-(2-chloro-5-fluorophenyl)sulfonylurea |
| SMILES | CC(C)(C)NC(=O)NS(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H14ClFN2O3S/c1-11(2,3)14-10(16)15-19(17,18)9-6-7(13)4-5-8(9)12/h4-6H,1-3H3,(H2,14,15,16) |
| InChIKey | KUSHIGHAAXTTRX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |