C15H13F3N2O4S — CID 22465630
5-[[4-(dimethylamino)phenyl]sulfamoyl]-2,3,4-trifluorobenzoic acid (PubChem CID 22465630) has the molecular formula C15H13F3N2O4S and a molecular weight of 374.34 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)phenyl]sulfamoyl]-2,3,4-trifluorobenzoic acid.
| Compound Name | 5-[[4-(dimethylamino)phenyl]sulfamoyl]-2,3,4-trifluorobenzoic acid |
|---|---|
| PubChem CID | 22465630 |
| Molecular Formula | C15H13F3N2O4S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 5-[[4-(dimethylamino)phenyl]sulfamoyl]-2,3,4-trifluorobenzoic acid |
| SMILES | CN(C)c1ccc(NS(=O)(=O)c2cc(C(=O)O)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H13F3N2O4S/c1-20(2)9-5-3-8(4-6-9)19-25(23,24)11-7-10(15(21)22)12(16)14(18)13(11)17/h3-7,19H,1-2H3,(H,21,22) |
| InChIKey | RJQNZBKNPDZAAQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|