C13H9F3N2O5S — CID 18148007
4-methoxy-2-nitro-N-(2,3,4-trifluorophenyl)benzenesulfonamide (PubChem CID 18148007) has the molecular formula C13H9F3N2O5S and a molecular weight of 362.29 g/mol. Its IUPAC name is 4-methoxy-2-nitro-N-(2,3,4-trifluorophenyl)benzenesulfonamide.
| Compound Name | 4-methoxy-2-nitro-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18148007 |
| Molecular Formula | C13H9F3N2O5S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 4-methoxy-2-nitro-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(F)c(F)c2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9F3N2O5S/c1-23-7-2-5-11(10(6-7)18(19)20)24(21,22)17-9-4-3-8(14)12(15)13(9)16/h2-6,17H,1H3 |
| InChIKey | LZCPYWDAOQBAHT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|