C13H10Cl2N2O5S — CID 18147971
N-(2,4-dichlorophenyl)-4-methoxy-2-nitrobenzenesulfonamide (PubChem CID 18147971) has the molecular formula C13H10Cl2N2O5S and a molecular weight of 377.21 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-methoxy-2-nitrobenzenesulfonamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-methoxy-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 18147971 |
| Molecular Formula | C13H10Cl2N2O5S |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-methoxy-2-nitrobenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10Cl2N2O5S/c1-22-9-3-5-13(12(7-9)17(18)19)23(20,21)16-11-4-2-8(14)6-10(11)15/h2-7,16H,1H3 |
| InChIKey | ISPAXFMQRRSPEO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|