C15H13ClN2O7S — CID 18148288
N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-4-methoxy-2-nitrobenzenesulfonamide (PubChem CID 18148288) has the molecular formula C15H13ClN2O7S and a molecular weight of 400.80 g/mol. Its IUPAC name is N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-4-methoxy-2-nitrobenzenesulfonamide.
| Compound Name | N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-4-methoxy-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 18148288 |
| Molecular Formula | C15H13ClN2O7S |
| Molecular Weight | 400.80 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-4-methoxy-2-nitrobenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc3c(cc2Cl)OCCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13ClN2O7S/c1-23-9-2-3-15(12(6-9)18(19)20)26(21,22)17-11-8-14-13(7-10(11)16)24-4-5-25-14/h2-3,6-8,17H,4-5H2,1H3 |
| InChIKey | LFOPLWPYGMMQSV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.80 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|