C17H21NO4S — CID 110673808
2-(3,4-dimethoxyphenyl)-N-(4-methylphenyl)ethanesulfonamide (PubChem CID 110673808) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(4-methylphenyl)ethanesulfonamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(4-methylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110673808 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(4-methylphenyl)ethanesulfonamide |
| SMILES | COc1ccc(CCS(=O)(=O)Nc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C17H21NO4S/c1-13-4-7-15(8-5-13)18-23(19,20)11-10-14-6-9-16(21-2)17(12-14)22-3/h4-9,12,18H,10-11H2,1-3H3 |
| InChIKey | AKIJXCAOKOBLQX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |