C20H26N3NaO7S — CID 23709772
sodium;3-[[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]amino]benzamide;methanesulfonate (PubChem CID 23709772) has the molecular formula C20H26N3NaO7S and a molecular weight of 475.50 g/mol. Its IUPAC name is sodium;3-[[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]amino]benzamide;methanesulfonate.
| Compound Name | sodium;3-[[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]amino]benzamide;methanesulfonate |
|---|---|
| PubChem CID | 23709772 |
| Molecular Formula | C20H26N3NaO7S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | sodium;3-[[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]amino]benzamide;methanesulfonate |
| SMILES | COc1ccc(CCNC(=O)CNc2cccc(C(N)=O)c2)cc1OC.CS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H23N3O4.CH4O3S.Na/c1-25-16-7-6-13(10-17(16)26-2)8-9-21-18(23)12-22-15-5-3-4-14(11-15)19(20)24;1-5(2,3)4;/h3-7,10-11,22H,8-9,12H2,1-2H3,(H2,20,24)(H,21,23);1H3,(H,2,3,4);/q;;+1/p-1 |
| InChIKey | BODLQJYWGRHQEV-UHFFFAOYSA-M |
| XLogP | -2.26 |
| TPSA | 159.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|