C18H20Cl3NO2 — CID 66529661
N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine (PubChem CID 66529661) has the molecular formula C18H20Cl3NO2 and a molecular weight of 388.72 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine.
| Compound Name | N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66529661 |
| Molecular Formula | C18H20Cl3NO2 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(OC)c(OCc2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl3NO2/c1-3-6-22-10-13-7-17(23-2)18(9-16(13)21)24-11-12-4-5-14(19)8-15(12)20/h4-5,7-9,22H,3,6,10-11H2,1-2H3 |
| InChIKey | CNGXIRXHEUHCFE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|