C24H23BrClNO4 — CID 66541272
N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 66541272) has the molecular formula C24H23BrClNO4 and a molecular weight of 504.81 g/mol. Its IUPAC name is N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 66541272 |
| Molecular Formula | C24H23BrClNO4 |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CCOc1cc(CNc2ccc3c(c2)OCCO3)c(Br)cc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H23BrClNO4/c1-2-28-22-11-17(14-27-19-6-7-21-23(12-19)30-9-8-29-21)20(25)13-24(22)31-15-16-4-3-5-18(26)10-16/h3-7,10-13,27H,2,8-9,14-15H2,1H3 |
| InChIKey | CSZINGGIGQHHIH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|