C21H25BrClN3O — CID 17156531
N-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride (PubChem CID 17156531) has the molecular formula C21H25BrClN3O and a molecular weight of 450.81 g/mol. Its IUPAC name is N-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride.
| Compound Name | N-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17156531 |
| Molecular Formula | C21H25BrClN3O |
| Molecular Weight | 450.81 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
| SMILES | Cc1ccc(COc2ccc(Br)cc2CNCCCn2ccnc2)cc1.Cl |
| InChI | InChI=1S/C21H24BrN3O.ClH/c1-17-3-5-18(6-4-17)15-26-21-8-7-20(22)13-19(21)14-23-9-2-11-25-12-10-24-16-25;/h3-8,10,12-13,16,23H,2,9,11,14-15H2,1H3;1H |
| InChIKey | OAJSLEBBRUONJO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.81 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|