C18H21BrClNO — CID 17056969
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]butan-1-amine (PubChem CID 17056969) has the molecular formula C18H21BrClNO and a molecular weight of 382.73 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]butan-1-amine.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 17056969 |
| Molecular Formula | C18H21BrClNO |
| Molecular Weight | 382.73 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]butan-1-amine |
| SMILES | CCCCNCc1ccc(OCc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C18H21BrClNO/c1-2-3-10-21-12-15-6-9-18(17(19)11-15)22-13-14-4-7-16(20)8-5-14/h4-9,11,21H,2-3,10,12-13H2,1H3 |
| InChIKey | QTIYXUPBICUVMD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|