C18H20Cl2FNO — CID 29225270
N-[(3,5-dichloro-2-propoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine (PubChem CID 29225270) has the molecular formula C18H20Cl2FNO and a molecular weight of 356.27 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-propoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine.
| Compound Name | N-[(3,5-dichloro-2-propoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 29225270 |
| Molecular Formula | C18H20Cl2FNO |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-[(3,5-dichloro-2-propoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine |
| SMILES | CCCOc1c(Cl)cc(Cl)cc1CNCCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H20Cl2FNO/c1-2-9-23-18-14(10-15(19)11-17(18)20)12-22-8-7-13-3-5-16(21)6-4-13/h3-6,10-11,22H,2,7-9,12H2,1H3 |
| InChIKey | LHXMYCWBMBFOGC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|