C19H23Cl2NO2 — CID 29225362
N-[(3,5-dichloro-2-propoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine (PubChem CID 29225362) has the molecular formula C19H23Cl2NO2 and a molecular weight of 368.30 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-propoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine.
| Compound Name | N-[(3,5-dichloro-2-propoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 29225362 |
| Molecular Formula | C19H23Cl2NO2 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[(3,5-dichloro-2-propoxyphenyl)methyl]-2-(2-methoxyphenyl)ethanamine |
| SMILES | CCCOc1c(Cl)cc(Cl)cc1CNCCc1ccccc1OC |
| InChI | InChI=1S/C19H23Cl2NO2/c1-3-10-24-19-15(11-16(20)12-17(19)21)13-22-9-8-14-6-4-5-7-18(14)23-2/h4-7,11-12,22H,3,8-10,13H2,1-2H3 |
| InChIKey | NHPNGQXIGDJMHN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|