C14H21Cl2NO3S — CID 65094121
N-[[3,5-dichloro-2-(3-ethylsulfonylpropoxy)phenyl]methyl]ethanamine (PubChem CID 65094121) has the molecular formula C14H21Cl2NO3S and a molecular weight of 354.30 g/mol. Its IUPAC name is N-[[3,5-dichloro-2-(3-ethylsulfonylpropoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[3,5-dichloro-2-(3-ethylsulfonylpropoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 65094121 |
| Molecular Formula | C14H21Cl2NO3S |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-[[3,5-dichloro-2-(3-ethylsulfonylpropoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Cl)cc(Cl)c1OCCCS(=O)(=O)CC |
| InChI | InChI=1S/C14H21Cl2NO3S/c1-3-17-10-11-8-12(15)9-13(16)14(11)20-6-5-7-21(18,19)4-2/h8-9,17H,3-7,10H2,1-2H3 |
| InChIKey | HQYOZXZKLRCVRJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|